C21H24N6O — CID 35757512
(E)-3-phenyl-1-[4-(1,3,5-trimethylpyrazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 35757512) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is (E)-3-phenyl-1-[4-(1,3,5-trimethylpyrazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-phenyl-1-[4-(1,3,5-trimethylpyrazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 35757512 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (E)-3-phenyl-1-[4-(1,3,5-trimethylpyrazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1nc(N2CCN(C(=O)/C=C/c3ccccc3)CC2)c2c(n1)c(C)nn2C |
| InChI | InChI=1S/C21H24N6O/c1-15-19-20(25(3)24-15)21(23-16(2)22-19)27-13-11-26(12-14-27)18(28)10-9-17-7-5-4-6-8-17/h4-10H,11-14H2,1-3H3/b10-9+ |
| InChIKey | CCEHEVYZTNVKEJ-MDZDMXLPSA-N |
| XLogP | 2.34 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|