C23H30N6O — CID 121031928
(E)-1-[4-[4-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]piperazin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 121031928) has the molecular formula C23H30N6O and a molecular weight of 406.53 g/mol. Its IUPAC name is (E)-1-[4-[4-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]piperazin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[4-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]piperazin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 121031928 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | (E)-1-[4-[4-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]piperazin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | Cc1cc(N2CCN(C)CC2)nc(N2CCN(C(=O)/C=C/c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C23H30N6O/c1-19-18-21(27-12-10-26(2)11-13-27)25-23(24-19)29-16-14-28(15-17-29)22(30)9-8-20-6-4-3-5-7-20/h3-9,18H,10-17H2,1-2H3/b9-8+ |
| InChIKey | ORAGJRFXQNBNNJ-CMDGGOBGSA-N |
| XLogP | 1.90 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|