C18H21N5O — CID 56784847
(E)-1-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-pyridin-3-ylprop-2-en-1-one (PubChem CID 56784847) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is (E)-1-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-pyridin-3-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-pyridin-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 56784847 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (E)-1-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-pyridin-3-ylprop-2-en-1-one |
| SMILES | Cc1cc(N2CCN(C(=O)/C=C/c3cccnc3)CC2)nc(C)n1 |
| InChI | InChI=1S/C18H21N5O/c1-14-12-17(21-15(2)20-14)22-8-10-23(11-9-22)18(24)6-5-16-4-3-7-19-13-16/h3-7,12-13H,8-11H2,1-2H3/b6-5+ |
| InChIKey | ZEGGDQLZFNYJFB-AATRIKPKSA-N |
| XLogP | 1.85 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|