C23H26N2O5 — CID 3850826
but-2-ynyl 8-(7-methoxy-1-benzofuran-2-carbonyl)-2,8-diazaspiro[4.5]decane-2-carboxylate (PubChem CID 3850826) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is but-2-ynyl 8-(7-methoxy-1-benzofuran-2-carbonyl)-2,8-diazaspiro[4.5]decane-2-carboxylate.
| Compound Name | but-2-ynyl 8-(7-methoxy-1-benzofuran-2-carbonyl)-2,8-diazaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 3850826 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | but-2-ynyl 8-(7-methoxy-1-benzofuran-2-carbonyl)-2,8-diazaspiro[4.5]decane-2-carboxylate |
| SMILES | CC#CCOC(=O)N1CCC2(CCN(C(=O)c3cc4cccc(OC)c4o3)CC2)C1 |
| InChI | InChI=1S/C23H26N2O5/c1-3-4-14-29-22(27)25-13-10-23(16-25)8-11-24(12-9-23)21(26)19-15-17-6-5-7-18(28-2)20(17)30-19/h5-7,15H,8-14,16H2,1-2H3 |
| InChIKey | PBUVLAOYONXTNM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|