C24H29N5O3S — CID 74229495
2-[3-(carbamothioylamino)benzoyl]-N-(2-methoxyphenyl)-2,8-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 74229495) has the molecular formula C24H29N5O3S and a molecular weight of 467.60 g/mol. Its IUPAC name is 2-[3-(carbamothioylamino)benzoyl]-N-(2-methoxyphenyl)-2,8-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | 2-[3-(carbamothioylamino)benzoyl]-N-(2-methoxyphenyl)-2,8-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 74229495 |
| Molecular Formula | C24H29N5O3S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 2-[3-(carbamothioylamino)benzoyl]-N-(2-methoxyphenyl)-2,8-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | COc1ccccc1NC(=O)N1CCC2(CC1)CCN(C(=O)c1cccc(NC(N)=S)c1)C2 |
| InChI | InChI=1S/C24H29N5O3S/c1-32-20-8-3-2-7-19(20)27-23(31)28-12-9-24(10-13-28)11-14-29(16-24)21(30)17-5-4-6-18(15-17)26-22(25)33/h2-8,15H,9-14,16H2,1H3,(H,27,31)(H3,25,26,33) |
| InChIKey | WNQXBUPHZGFAET-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|