C13H19F3N2O4 — CID 146121328
1-[methyl(oxan-4-yl)carbamoyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 146121328) has the molecular formula C13H19F3N2O4 and a molecular weight of 324.30 g/mol. Its IUPAC name is 1-[methyl(oxan-4-yl)carbamoyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[methyl(oxan-4-yl)carbamoyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 146121328 |
| Molecular Formula | C13H19F3N2O4 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-[methyl(oxan-4-yl)carbamoyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | CN(C(=O)N1CCC(C(=O)O)(C(F)(F)F)C1)C1CCOCC1 |
| InChI | InChI=1S/C13H19F3N2O4/c1-17(9-2-6-22-7-3-9)11(21)18-5-4-12(8-18,10(19)20)13(14,15)16/h9H,2-8H2,1H3,(H,19,20) |
| InChIKey | XGVVMOVBDQMHTK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |