C21H15FN4O2S — CID 7946021
N'-(4-fluorobenzoyl)-1-phenyl-3-thiophen-2-ylpyrazole-5-carbohydrazide (PubChem CID 7946021) has the molecular formula C21H15FN4O2S and a molecular weight of 406.44 g/mol. Its IUPAC name is N'-(4-fluorobenzoyl)-1-phenyl-3-thiophen-2-ylpyrazole-5-carbohydrazide.
| Compound Name | N'-(4-fluorobenzoyl)-1-phenyl-3-thiophen-2-ylpyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 7946021 |
| Molecular Formula | C21H15FN4O2S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N'-(4-fluorobenzoyl)-1-phenyl-3-thiophen-2-ylpyrazole-5-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(-c2cccs2)nn1-c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H15FN4O2S/c22-15-10-8-14(9-11-15)20(27)23-24-21(28)18-13-17(19-7-4-12-29-19)25-26(18)16-5-2-1-3-6-16/h1-13H,(H,23,27)(H,24,28) |
| InChIKey | GVDQCYOJJVXODG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|