C23H26N8O — CID 71129330
8-ethyl-4-methyl-2-(4-piperazin-1-ylanilino)-6-(1H-pyrazol-5-yl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 71129330) has the molecular formula C23H26N8O and a molecular weight of 430.52 g/mol. Its IUPAC name is 8-ethyl-4-methyl-2-(4-piperazin-1-ylanilino)-6-(1H-pyrazol-5-yl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-ethyl-4-methyl-2-(4-piperazin-1-ylanilino)-6-(1H-pyrazol-5-yl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 71129330 |
| Molecular Formula | C23H26N8O |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 8-ethyl-4-methyl-2-(4-piperazin-1-ylanilino)-6-(1H-pyrazol-5-yl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCn1c(=O)c(-c2ccn[nH]2)cc2c(C)nc(Nc3ccc(N4CCNCC4)cc3)nc21 |
| InChI | InChI=1S/C23H26N8O/c1-3-31-21-18(14-19(22(31)32)20-8-9-25-29-20)15(2)26-23(28-21)27-16-4-6-17(7-5-16)30-12-10-24-11-13-30/h4-9,14,24H,3,10-13H2,1-2H3,(H,25,29)(H,26,27,28) |
| InChIKey | DLOQYGXOPXQHGW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|