C12H15N5O — CID 136920355
3-[2-(methylamino)ethylamino]-6-phenyl-4H-1,2,4-triazin-5-one (PubChem CID 136920355) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is 3-[2-(methylamino)ethylamino]-6-phenyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[2-(methylamino)ethylamino]-6-phenyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136920355 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 3-[2-(methylamino)ethylamino]-6-phenyl-4H-1,2,4-triazin-5-one |
| SMILES | CNCCNc1nnc(-c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H15N5O/c1-13-7-8-14-12-15-11(18)10(16-17-12)9-5-3-2-4-6-9/h2-6,13H,7-8H2,1H3,(H2,14,15,17,18) |
| InChIKey | AUBOSBXHMLUQQS-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|