C18H18N4O2 — CID 135612014
3-[2-(4-methoxyphenyl)ethylamino]-6-phenyl-4H-1,2,4-triazin-5-one (PubChem CID 135612014) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)ethylamino]-6-phenyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[2-(4-methoxyphenyl)ethylamino]-6-phenyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135612014 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)ethylamino]-6-phenyl-4H-1,2,4-triazin-5-one |
| SMILES | COc1ccc(CCNc2nnc(-c3ccccc3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C18H18N4O2/c1-24-15-9-7-13(8-10-15)11-12-19-18-20-17(23)16(21-22-18)14-5-3-2-4-6-14/h2-10H,11-12H2,1H3,(H2,19,20,22,23) |
| InChIKey | XGCNRHPBJWGBTP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |