C19H20N4O3 — CID 135511625
3-[2-(3,4-dimethoxyphenyl)ethylamino]-6-phenyl-4H-1,2,4-triazin-5-one (PubChem CID 135511625) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethylamino]-6-phenyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethylamino]-6-phenyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135511625 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethylamino]-6-phenyl-4H-1,2,4-triazin-5-one |
| SMILES | COc1ccc(CCNc2nnc(-c3ccccc3)c(=O)[nH]2)cc1OC |
| InChI | InChI=1S/C19H20N4O3/c1-25-15-9-8-13(12-16(15)26-2)10-11-20-19-21-18(24)17(22-23-19)14-6-4-3-5-7-14/h3-9,12H,10-11H2,1-2H3,(H2,20,21,23,24) |
| InChIKey | XFHWNUZBSDJDJS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |