C14H17N3O4 — CID 2727844
2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 2727844) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 2727844 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | COc1ccc(CCNc2nc(O)cc(=O)[nH]2)cc1OC |
| InChI | InChI=1S/C14H17N3O4/c1-20-10-4-3-9(7-11(10)21-2)5-6-15-14-16-12(18)8-13(19)17-14/h3-4,7-8H,5-6H2,1-2H3,(H3,15,16,17,18,19) |
| InChIKey | RUQRJHNBMSHUOJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |