C21H24N2O5 — CID 155920037
4-[2-(3,4-dimethoxyphenyl)ethylamino]-7,8-dimethoxy-1H-quinolin-2-one (PubChem CID 155920037) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 4-[2-(3,4-dimethoxyphenyl)ethylamino]-7,8-dimethoxy-1H-quinolin-2-one.
| Compound Name | 4-[2-(3,4-dimethoxyphenyl)ethylamino]-7,8-dimethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 155920037 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 4-[2-(3,4-dimethoxyphenyl)ethylamino]-7,8-dimethoxy-1H-quinolin-2-one |
| SMILES | COc1ccc(CCNc2cc(=O)[nH]c3c(OC)c(OC)ccc23)cc1OC |
| InChI | InChI=1S/C21H24N2O5/c1-25-16-7-5-13(11-18(16)27-3)9-10-22-15-12-19(24)23-20-14(15)6-8-17(26-2)21(20)28-4/h5-8,11-12H,9-10H2,1-4H3,(H2,22,23,24) |
| InChIKey | DTCOKNWRNFBFAZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |