C16H19ClN2O2 — CID 115468478
4-chloro-2-N-[2-(3,4-dimethoxyphenyl)ethyl]benzene-1,2-diamine (PubChem CID 115468478) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is 4-chloro-2-N-[2-(3,4-dimethoxyphenyl)ethyl]benzene-1,2-diamine.
| Compound Name | 4-chloro-2-N-[2-(3,4-dimethoxyphenyl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 115468478 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 4-chloro-2-N-[2-(3,4-dimethoxyphenyl)ethyl]benzene-1,2-diamine |
| SMILES | COc1ccc(CCNc2cc(Cl)ccc2N)cc1OC |
| InChI | InChI=1S/C16H19ClN2O2/c1-20-15-6-3-11(9-16(15)21-2)7-8-19-14-10-12(17)4-5-13(14)18/h3-6,9-10,19H,7-8,18H2,1-2H3 |
| InChIKey | OAGWKPPTXCZZFL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|