C15H17ClN2O2 — CID 83001192
2-N-[(4-chlorophenyl)methyl]-4,5-dimethoxybenzene-1,2-diamine (PubChem CID 83001192) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 2-N-[(4-chlorophenyl)methyl]-4,5-dimethoxybenzene-1,2-diamine.
| Compound Name | 2-N-[(4-chlorophenyl)methyl]-4,5-dimethoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 83001192 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-N-[(4-chlorophenyl)methyl]-4,5-dimethoxybenzene-1,2-diamine |
| SMILES | COc1cc(N)c(NCc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C15H17ClN2O2/c1-19-14-7-12(17)13(8-15(14)20-2)18-9-10-3-5-11(16)6-4-10/h3-8,18H,9,17H2,1-2H3 |
| InChIKey | PWZXSVGFVHCNCO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|