C15H20N4O2 — CID 136780374
6-(4-methoxyphenyl)-3-(3-methylbutylamino)-4H-1,2,4-triazin-5-one (PubChem CID 136780374) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-3-(3-methylbutylamino)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-(4-methoxyphenyl)-3-(3-methylbutylamino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136780374 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 6-(4-methoxyphenyl)-3-(3-methylbutylamino)-4H-1,2,4-triazin-5-one |
| SMILES | COc1ccc(-c2nnc(NCCC(C)C)[nH]c2=O)cc1 |
| InChI | InChI=1S/C15H20N4O2/c1-10(2)8-9-16-15-17-14(20)13(18-19-15)11-4-6-12(21-3)7-5-11/h4-7,10H,8-9H2,1-3H3,(H2,16,17,19,20) |
| InChIKey | PTKAEQYPASCWOA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |