C16H12F2N4O2 — CID 136779313
3-(2,5-difluoroanilino)-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one (PubChem CID 136779313) has the molecular formula C16H12F2N4O2 and a molecular weight of 330.29 g/mol. Its IUPAC name is 3-(2,5-difluoroanilino)-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(2,5-difluoroanilino)-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136779313 |
| Molecular Formula | C16H12F2N4O2 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-(2,5-difluoroanilino)-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one |
| SMILES | COc1ccc(-c2nnc(Nc3cc(F)ccc3F)[nH]c2=O)cc1 |
| InChI | InChI=1S/C16H12F2N4O2/c1-24-11-5-2-9(3-6-11)14-15(23)20-16(22-21-14)19-13-8-10(17)4-7-12(13)18/h2-8H,1H3,(H2,19,20,22,23) |
| InChIKey | CLSNHSDUNPJJJP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |