C12H14N4O3 — CID 135412294
3-(2,4-dimethoxyanilino)-6-methyl-4H-1,2,4-triazin-5-one (PubChem CID 135412294) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 3-(2,4-dimethoxyanilino)-6-methyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(2,4-dimethoxyanilino)-6-methyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135412294 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 3-(2,4-dimethoxyanilino)-6-methyl-4H-1,2,4-triazin-5-one |
| SMILES | COc1ccc(Nc2nnc(C)c(=O)[nH]2)c(OC)c1 |
| InChI | InChI=1S/C12H14N4O3/c1-7-11(17)14-12(16-15-7)13-9-5-4-8(18-2)6-10(9)19-3/h4-6H,1-3H3,(H2,13,14,16,17) |
| InChIKey | JQITULKPBZYIKU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |