C14H13N3O2S — CID 135442793
2-(4-methoxy-2-methylanilino)-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 135442793) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-(4-methoxy-2-methylanilino)-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-(4-methoxy-2-methylanilino)-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135442793 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-(4-methoxy-2-methylanilino)-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | COc1ccc(Nc2nc3ccsc3c(=O)[nH]2)c(C)c1 |
| InChI | InChI=1S/C14H13N3O2S/c1-8-7-9(19-2)3-4-10(8)15-14-16-11-5-6-20-12(11)13(18)17-14/h3-7H,1-2H3,(H2,15,16,17,18) |
| InChIKey | SJNKSOUAEPHZDY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |