C16H11F3N4O — CID 135658985
6-phenyl-3-[4-(trifluoromethyl)anilino]-4H-1,2,4-triazin-5-one (PubChem CID 135658985) has the molecular formula C16H11F3N4O and a molecular weight of 332.29 g/mol. Its IUPAC name is 6-phenyl-3-[4-(trifluoromethyl)anilino]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-phenyl-3-[4-(trifluoromethyl)anilino]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135658985 |
| Molecular Formula | C16H11F3N4O |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 6-phenyl-3-[4-(trifluoromethyl)anilino]-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(Nc2ccc(C(F)(F)F)cc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C16H11F3N4O/c17-16(18,19)11-6-8-12(9-7-11)20-15-21-14(24)13(22-23-15)10-4-2-1-3-5-10/h1-9H,(H2,20,21,23,24) |
| InChIKey | XSFMBAQIMOTAIX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |