C20H14F3N3 — CID 10215490
3-phenyl-N-[4-(trifluoromethyl)phenyl]-1H-indazol-6-amine (PubChem CID 10215490) has the molecular formula C20H14F3N3 and a molecular weight of 353.35 g/mol. Its IUPAC name is 3-phenyl-N-[4-(trifluoromethyl)phenyl]-1H-indazol-6-amine.
| Compound Name | 3-phenyl-N-[4-(trifluoromethyl)phenyl]-1H-indazol-6-amine |
|---|---|
| PubChem CID | 10215490 |
| Molecular Formula | C20H14F3N3 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 3-phenyl-N-[4-(trifluoromethyl)phenyl]-1H-indazol-6-amine |
| SMILES | FC(F)(F)c1ccc(Nc2ccc3c(-c4ccccc4)n[nH]c3c2)cc1 |
| InChI | InChI=1S/C20H14F3N3/c21-20(22,23)14-6-8-15(9-7-14)24-16-10-11-17-18(12-16)25-26-19(17)13-4-2-1-3-5-13/h1-12,24H,(H,25,26) |
| InChIKey | KHYYBEXKTFKQFM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |