C19H14N4O2S — CID 136779061
3-(4-phenoxyanilino)-6-thiophen-2-yl-4H-1,2,4-triazin-5-one (PubChem CID 136779061) has the molecular formula C19H14N4O2S and a molecular weight of 362.41 g/mol. Its IUPAC name is 3-(4-phenoxyanilino)-6-thiophen-2-yl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(4-phenoxyanilino)-6-thiophen-2-yl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136779061 |
| Molecular Formula | C19H14N4O2S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 3-(4-phenoxyanilino)-6-thiophen-2-yl-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(Nc2ccc(Oc3ccccc3)cc2)nnc1-c1cccs1 |
| InChI | InChI=1S/C19H14N4O2S/c24-18-17(16-7-4-12-26-16)22-23-19(21-18)20-13-8-10-15(11-9-13)25-14-5-2-1-3-6-14/h1-12H,(H2,20,21,23,24) |
| InChIKey | COSWWZCPOUCTIR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |