C7H7N5OS — CID 135843306
3-hydrazinyl-6-thiophen-2-yl-4H-1,2,4-triazin-5-one (PubChem CID 135843306) has the molecular formula C7H7N5OS and a molecular weight of 209.23 g/mol. Its IUPAC name is 3-hydrazinyl-6-thiophen-2-yl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-hydrazinyl-6-thiophen-2-yl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135843306 |
| Molecular Formula | C7H7N5OS |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 3-hydrazinyl-6-thiophen-2-yl-4H-1,2,4-triazin-5-one |
| SMILES | NNc1nnc(-c2cccs2)c(=O)[nH]1 |
| InChI | InChI=1S/C7H7N5OS/c8-10-7-9-6(13)5(11-12-7)4-2-1-3-14-4/h1-3H,8H2,(H2,9,10,12,13) |
| InChIKey | HLKVEUDXDMHFCP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|