About 4-amino-3-tert-butyl-6-thiophen-2-yl-1,2,4-triazin-5-one
4-amino-3-tert-butyl-6-thiophen-2-yl-1,2,4-triazin-5-one (PubChem CID 22757952) has the molecular formula C11H14N4OS
and a molecular weight of 250.33 g/mol. Its IUPAC name is 4-amino-3-tert-butyl-6-thiophen-2-yl-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | 4-amino-3-tert-butyl-6-thiophen-2-yl-1,2,4-triazin-5-one |
| PubChem CID | 22757952 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 4-amino-3-tert-butyl-6-thiophen-2-yl-1,2,4-triazin-5-one |
| SMILES | CC(C)(C)c1nnc(-c2cccs2)c(=O)n1N |
| InChI | InChI=1S/C11H14N4OS/c1-11(2,3)10-14-13-8(9(16)15(10)12)7-5-4-6-17-7/h4-6H,12H2,1-3H3 |
| InChIKey | LQANPMBHLAMPQP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-3-tert-butyl-6-thiophen-2-yl-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-tert-butyl-6-thiophen-2-yl-1,2,4-triazin-5-one?
The IUPAC name of 4-amino-3-tert-butyl-6-thiophen-2-yl-1,2,4-triazin-5-one (CID 22757952) is 4-amino-3-tert-butyl-6-thiophen-2-yl-1,2,4-triazin-5-one.
What is the SMILES notation for 4-amino-3-tert-butyl-6-thiophen-2-yl-1,2,4-triazin-5-one?
The canonical SMILES for 4-amino-3-tert-butyl-6-thiophen-2-yl-1,2,4-triazin-5-one is CC(C)(C)c1nnc(-c2cccs2)c(=O)n1N.
What is the InChIKey of 4-amino-3-tert-butyl-6-thiophen-2-yl-1,2,4-triazin-5-one?
The InChIKey is LQANPMBHLAMPQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4OS/c1-11(2,3)10-14-13-8(9(16)15(10)12)7-5-4-6-17-7/h4-6H,12H2,1-3H3.
What are the key properties of 4-amino-3-tert-butyl-6-thiophen-2-yl-1,2,4-triazin-5-one?
4-amino-3-tert-butyl-6-thiophen-2-yl-1,2,4-triazin-5-one has a molecular weight of 250.33 g/mol, XLogP of 1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-tert-butyl-6-thiophen-2-yl-1,2,4-triazin-5-one is sourced from PubChem (CID 22757952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).