C15H14N4OS — CID 136779508
3-(2-ethylanilino)-6-thiophen-2-yl-4H-1,2,4-triazin-5-one (PubChem CID 136779508) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is 3-(2-ethylanilino)-6-thiophen-2-yl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(2-ethylanilino)-6-thiophen-2-yl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136779508 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 3-(2-ethylanilino)-6-thiophen-2-yl-4H-1,2,4-triazin-5-one |
| SMILES | CCc1ccccc1Nc1nnc(-c2cccs2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H14N4OS/c1-2-10-6-3-4-7-11(10)16-15-17-14(20)13(18-19-15)12-8-5-9-21-12/h3-9H,2H2,1H3,(H2,16,17,19,20) |
| InChIKey | LNIDTBBJQASRJP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |