C14H15N3OS — CID 136779495
2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one (PubChem CID 136779495) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one.
| Compound Name | 2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136779495 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one |
| SMILES | CCc1ccccc1Nc1nc2c(c(=O)[nH]1)CSC2 |
| InChI | InChI=1S/C14H15N3OS/c1-2-9-5-3-4-6-11(9)15-14-16-12-8-19-7-10(12)13(18)17-14/h3-6H,2,7-8H2,1H3,(H2,15,16,17,18) |
| InChIKey | BSCYCFWWZJNASR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |