About 2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one
2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one (PubChem CID 136779495) has the molecular formula C14H15N3OS
and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one |
| PubChem CID | 136779495 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one |
| SMILES | CCc1ccccc1Nc1nc2c(c(=O)[nH]1)CSC2 |
| InChI | InChI=1S/C14H15N3OS/c1-2-9-5-3-4-6-11(9)15-14-16-12-8-19-7-10(12)13(18)17-14/h3-6H,2,7-8H2,1H3,(H2,15,16,17,18) |
| InChIKey | BSCYCFWWZJNASR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one?
The IUPAC name of 2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one (CID 136779495) is 2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one?
The canonical SMILES for 2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one is CCc1ccccc1Nc1nc2c(c(=O)[nH]1)CSC2.
What is the InChIKey of 2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one?
The InChIKey is BSCYCFWWZJNASR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3OS/c1-2-9-5-3-4-6-11(9)15-14-16-12-8-19-7-10(12)13(18)17-14/h3-6H,2,7-8H2,1H3,(H2,15,16,17,18).
What are the key properties of 2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one?
2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one has a molecular weight of 273.36 g/mol, XLogP of 2.82, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethylanilino)-5,7-dihydro-3H-thieno[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 136779495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).