C16H10N4O3S — CID 162494500
4-[(5-isocyano-6-oxo-4-thiophen-2-yl-1H-pyrimidin-2-yl)amino]benzoic acid (PubChem CID 162494500) has the molecular formula C16H10N4O3S and a molecular weight of 338.35 g/mol. Its IUPAC name is 4-[(5-isocyano-6-oxo-4-thiophen-2-yl-1H-pyrimidin-2-yl)amino]benzoic acid.
| Compound Name | 4-[(5-isocyano-6-oxo-4-thiophen-2-yl-1H-pyrimidin-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 162494500 |
| Molecular Formula | C16H10N4O3S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 4-[(5-isocyano-6-oxo-4-thiophen-2-yl-1H-pyrimidin-2-yl)amino]benzoic acid |
| SMILES | [C-]#[N+]c1c(-c2cccs2)nc(Nc2ccc(C(=O)O)cc2)[nH]c1=O |
| InChI | InChI=1S/C16H10N4O3S/c1-17-13-12(11-3-2-8-24-11)19-16(20-14(13)21)18-10-6-4-9(5-7-10)15(22)23/h2-8H,(H,22,23)(H2,18,19,20,21) |
| InChIKey | DXDVPYVDHJTLIY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 99.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|