C22H18N2O2S2 — CID 158223355
4-[(3-isocyano-4-thiophen-2-yl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanylmethyl]benzoic acid (PubChem CID 158223355) has the molecular formula C22H18N2O2S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 4-[(3-isocyano-4-thiophen-2-yl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanylmethyl]benzoic acid.
| Compound Name | 4-[(3-isocyano-4-thiophen-2-yl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 158223355 |
| Molecular Formula | C22H18N2O2S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 4-[(3-isocyano-4-thiophen-2-yl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanylmethyl]benzoic acid |
| SMILES | [C-]#[N+]c1c(SCc2ccc(C(=O)O)cc2)nc2c(c1-c1cccs1)CCCC2 |
| InChI | InChI=1S/C22H18N2O2S2/c1-23-20-19(18-7-4-12-27-18)16-5-2-3-6-17(16)24-21(20)28-13-14-8-10-15(11-9-14)22(25)26/h4,7-12H,2-3,5-6,13H2,(H,25,26) |
| InChIKey | RAHIJRDHKZFYMT-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 54.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|