C24H19N3OS2 — CID 2746707
2-[(3-cyano-4-thiophen-2-yl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-(3-ethynylphenyl)acetamide (PubChem CID 2746707) has the molecular formula C24H19N3OS2 and a molecular weight of 429.57 g/mol. Its IUPAC name is 2-[(3-cyano-4-thiophen-2-yl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-(3-ethynylphenyl)acetamide.
| Compound Name | 2-[(3-cyano-4-thiophen-2-yl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-(3-ethynylphenyl)acetamide |
|---|---|
| PubChem CID | 2746707 |
| Molecular Formula | C24H19N3OS2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 2-[(3-cyano-4-thiophen-2-yl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-(3-ethynylphenyl)acetamide |
| SMILES | C#Cc1cccc(NC(=O)CSc2nc3c(c(-c4cccs4)c2C#N)CCCC3)c1 |
| InChI | InChI=1S/C24H19N3OS2/c1-2-16-7-5-8-17(13-16)26-22(28)15-30-24-19(14-25)23(21-11-6-12-29-21)18-9-3-4-10-20(18)27-24/h1,5-8,11-13H,3-4,9-10,15H2,(H,26,28) |
| InChIKey | ZFJUUHDOHLWLQW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|