C22H19N3O2S2 — CID 25065638
2-[(3-cyano-4-thiophen-2-yl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-(2-hydroxyphenyl)acetamide (PubChem CID 25065638) has the molecular formula C22H19N3O2S2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 2-[(3-cyano-4-thiophen-2-yl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-(2-hydroxyphenyl)acetamide.
| Compound Name | 2-[(3-cyano-4-thiophen-2-yl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 25065638 |
| Molecular Formula | C22H19N3O2S2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2-[(3-cyano-4-thiophen-2-yl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-(2-hydroxyphenyl)acetamide |
| SMILES | N#Cc1c(SCC(=O)Nc2ccccc2O)nc2c(c1-c1cccs1)CCCC2 |
| InChI | InChI=1S/C22H19N3O2S2/c23-12-15-21(19-10-5-11-28-19)14-6-1-2-7-16(14)25-22(15)29-13-20(27)24-17-8-3-4-9-18(17)26/h3-5,8-11,26H,1-2,6-7,13H2,(H,24,27) |
| InChIKey | XVITUXSXODMGQQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|