C23H17ClN4O3S — CID 142008235
N-[4-[2-(4-chloroanilino)-5-methyl-6-oxo-1H-pyrimidin-4-yl]phenyl]-2-oxo-2-thiophen-2-ylacetamide (PubChem CID 142008235) has the molecular formula C23H17ClN4O3S and a molecular weight of 464.93 g/mol. Its IUPAC name is N-[4-[2-(4-chloroanilino)-5-methyl-6-oxo-1H-pyrimidin-4-yl]phenyl]-2-oxo-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-[2-(4-chloroanilino)-5-methyl-6-oxo-1H-pyrimidin-4-yl]phenyl]-2-oxo-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 142008235 |
| Molecular Formula | C23H17ClN4O3S |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | N-[4-[2-(4-chloroanilino)-5-methyl-6-oxo-1H-pyrimidin-4-yl]phenyl]-2-oxo-2-thiophen-2-ylacetamide |
| SMILES | Cc1c(-c2ccc(NC(=O)C(=O)c3cccs3)cc2)nc(Nc2ccc(Cl)cc2)[nH]c1=O |
| InChI | InChI=1S/C23H17ClN4O3S/c1-13-19(27-23(28-21(13)30)26-17-10-6-15(24)7-11-17)14-4-8-16(9-5-14)25-22(31)20(29)18-3-2-12-32-18/h2-12H,1H3,(H,25,31)(H2,26,27,28,30) |
| InChIKey | VPZJCEASAYHWBR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|