C22H14ClN5O3 — CID 135682381
N-[4-[2-(4-chloroanilino)-5-cyano-6-oxo-1H-pyrimidin-4-yl]phenyl]furan-3-carboxamide (PubChem CID 135682381) has the molecular formula C22H14ClN5O3 and a molecular weight of 431.84 g/mol. Its IUPAC name is N-[4-[2-(4-chloroanilino)-5-cyano-6-oxo-1H-pyrimidin-4-yl]phenyl]furan-3-carboxamide.
| Compound Name | N-[4-[2-(4-chloroanilino)-5-cyano-6-oxo-1H-pyrimidin-4-yl]phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 135682381 |
| Molecular Formula | C22H14ClN5O3 |
| Molecular Weight | 431.84 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | N-[4-[2-(4-chloroanilino)-5-cyano-6-oxo-1H-pyrimidin-4-yl]phenyl]furan-3-carboxamide |
| SMILES | N#Cc1c(-c2ccc(NC(=O)c3ccoc3)cc2)nc(Nc2ccc(Cl)cc2)[nH]c1=O |
| InChI | InChI=1S/C22H14ClN5O3/c23-15-3-7-17(8-4-15)26-22-27-19(18(11-24)21(30)28-22)13-1-5-16(6-2-13)25-20(29)14-9-10-31-12-14/h1-10,12H,(H,25,29)(H2,26,27,28,30) |
| InChIKey | LVLCVGIVLFRCBJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.84 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|