C19H13ClN4O3 — CID 135682142
2-(4-chloroanilino)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 135682142) has the molecular formula C19H13ClN4O3 and a molecular weight of 380.79 g/mol. Its IUPAC name is 2-(4-chloroanilino)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-(4-chloroanilino)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 135682142 |
| Molecular Formula | C19H13ClN4O3 |
| Molecular Weight | 380.79 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-(4-chloroanilino)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccc3c(c2)OCCO3)nc(Nc2ccc(Cl)cc2)[nH]c1=O |
| InChI | InChI=1S/C19H13ClN4O3/c20-12-2-4-13(5-3-12)22-19-23-17(14(10-21)18(25)24-19)11-1-6-15-16(9-11)27-8-7-26-15/h1-6,9H,7-8H2,(H2,22,23,24,25) |
| InChIKey | CDYNBKFBJUHNMP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|