C17H9Cl3N4O — CID 135476213
2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 135476213) has the molecular formula C17H9Cl3N4O and a molecular weight of 391.65 g/mol. Its IUPAC name is 2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 135476213 |
| Molecular Formula | C17H9Cl3N4O |
| Molecular Weight | 391.65 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | 2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Cl)cc2Cl)nc(Nc2ccc(Cl)cc2)[nH]c1=O |
| InChI | InChI=1S/C17H9Cl3N4O/c18-9-1-4-11(5-2-9)22-17-23-15(13(8-21)16(25)24-17)12-6-3-10(19)7-14(12)20/h1-7H,(H2,22,23,24,25) |
| InChIKey | PRXIBJVHGJXUIB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.65 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|