About 2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile
2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 135476213) has the molecular formula C17H9Cl3N4O
and a molecular weight of 391.65 g/mol. Its IUPAC name is 2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile |
| PubChem CID | 135476213 |
| Molecular Formula | C17H9Cl3N4O |
| Molecular Weight | 391.65 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | 2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Cl)cc2Cl)nc(Nc2ccc(Cl)cc2)[nH]c1=O |
| InChI | InChI=1S/C17H9Cl3N4O/c18-9-1-4-11(5-2-9)22-17-23-15(13(8-21)16(25)24-17)12-6-3-10(19)7-14(12)20/h1-7H,(H2,22,23,24,25) |
| InChIKey | PRXIBJVHGJXUIB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.65 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile?
The IUPAC name of 2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile (CID 135476213) is 2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile.
What is the SMILES notation for 2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile?
The canonical SMILES for 2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile is N#Cc1c(-c2ccc(Cl)cc2Cl)nc(Nc2ccc(Cl)cc2)[nH]c1=O.
What is the InChIKey of 2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile?
The InChIKey is PRXIBJVHGJXUIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9Cl3N4O/c18-9-1-4-11(5-2-9)22-17-23-15(13(8-21)16(25)24-17)12-6-3-10(19)7-14(12)20/h1-7H,(H2,22,23,24,25).
What are the key properties of 2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile?
2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile has a molecular weight of 391.65 g/mol, XLogP of 5.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloroanilino)-4-(2,4-dichlorophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile is sourced from PubChem (CID 135476213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).