C19H17ClN6O3S — CID 135682168
2-(4-chloroanilino)-5-cyano-4-[4-(dimethylsulfamoylamino)phenyl]-6-oxo-1H-pyrimidine (PubChem CID 135682168) has the molecular formula C19H17ClN6O3S and a molecular weight of 444.90 g/mol. Its IUPAC name is 2-(4-chloroanilino)-5-cyano-4-[4-(dimethylsulfamoylamino)phenyl]-6-oxo-1H-pyrimidine.
| Compound Name | 2-(4-chloroanilino)-5-cyano-4-[4-(dimethylsulfamoylamino)phenyl]-6-oxo-1H-pyrimidine |
|---|---|
| PubChem CID | 135682168 |
| Molecular Formula | C19H17ClN6O3S |
| Molecular Weight | 444.90 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 2-(4-chloroanilino)-5-cyano-4-[4-(dimethylsulfamoylamino)phenyl]-6-oxo-1H-pyrimidine |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(-c2nc(Nc3ccc(Cl)cc3)[nH]c(=O)c2C#N)cc1 |
| InChI | InChI=1S/C19H17ClN6O3S/c1-26(2)30(28,29)25-15-7-3-12(4-8-15)17-16(11-21)18(27)24-19(23-17)22-14-9-5-13(20)6-10-14/h3-10,25H,1-2H3,(H2,22,23,24,27) |
| InChIKey | CCGHHCYFBANLCZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.90 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|