C18H14ClN5O3S — CID 135682384
N-[4-[2-(4-chloroanilino)-5-cyano-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide (PubChem CID 135682384) has the molecular formula C18H14ClN5O3S and a molecular weight of 415.86 g/mol. Its IUPAC name is N-[4-[2-(4-chloroanilino)-5-cyano-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-(4-chloroanilino)-5-cyano-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 135682384 |
| Molecular Formula | C18H14ClN5O3S |
| Molecular Weight | 415.86 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | N-[4-[2-(4-chloroanilino)-5-cyano-6-oxo-1H-pyrimidin-4-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2nc(Nc3ccc(Cl)cc3)[nH]c(=O)c2C#N)cc1 |
| InChI | InChI=1S/C18H14ClN5O3S/c1-28(26,27)24-14-6-2-11(3-7-14)16-15(10-20)17(25)23-18(22-16)21-13-8-4-12(19)5-9-13/h2-9,24H,1H3,(H2,21,22,23,25) |
| InChIKey | DLXXRUJJRLBSFD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.86 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|