C15H14BrN3O2 — CID 159345734
4-(1H-benzimidazol-2-ylamino)benzoic acid;bromomethane (PubChem CID 159345734) has the molecular formula C15H14BrN3O2 and a molecular weight of 348.20 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylamino)benzoic acid;bromomethane.
| Compound Name | 4-(1H-benzimidazol-2-ylamino)benzoic acid;bromomethane |
|---|---|
| PubChem CID | 159345734 |
| Molecular Formula | C15H14BrN3O2 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylamino)benzoic acid;bromomethane |
| SMILES | CBr.O=C(O)c1ccc(Nc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C14H11N3O2.CH3Br/c18-13(19)9-5-7-10(8-6-9)15-14-16-11-3-1-2-4-12(11)17-14;1-2/h1-8H,(H,18,19)(H2,15,16,17);1H3 |
| InChIKey | LGRWHYIKJNYZKL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|