C26H20N4O — CID 156631123
N-[3-(1H-benzimidazol-2-ylamino)phenyl]-4-phenylbenzamide (PubChem CID 156631123) has the molecular formula C26H20N4O and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-ylamino)phenyl]-4-phenylbenzamide.
| Compound Name | N-[3-(1H-benzimidazol-2-ylamino)phenyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 156631123 |
| Molecular Formula | C26H20N4O |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-ylamino)phenyl]-4-phenylbenzamide |
| SMILES | O=C(Nc1cccc(Nc2nc3ccccc3[nH]2)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H20N4O/c31-25(20-15-13-19(14-16-20)18-7-2-1-3-8-18)27-21-9-6-10-22(17-21)28-26-29-23-11-4-5-12-24(23)30-26/h1-17H,(H,27,31)(H2,28,29,30) |
| InChIKey | QCEYEVSUFMOMGL-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |