C27H30N6O — CID 156631177
N-[3-(1H-benzimidazol-2-ylamino)phenyl]-4-[(4-ethylpiperazin-1-yl)methyl]benzamide (PubChem CID 156631177) has the molecular formula C27H30N6O and a molecular weight of 454.58 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-ylamino)phenyl]-4-[(4-ethylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-[3-(1H-benzimidazol-2-ylamino)phenyl]-4-[(4-ethylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 156631177 |
| Molecular Formula | C27H30N6O |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-ylamino)phenyl]-4-[(4-ethylpiperazin-1-yl)methyl]benzamide |
| SMILES | CCN1CCN(Cc2ccc(C(=O)Nc3cccc(Nc4nc5ccccc5[nH]4)c3)cc2)CC1 |
| InChI | InChI=1S/C27H30N6O/c1-2-32-14-16-33(17-15-32)19-20-10-12-21(13-11-20)26(34)28-22-6-5-7-23(18-22)29-27-30-24-8-3-4-9-25(24)31-27/h3-13,18H,2,14-17,19H2,1H3,(H,28,34)(H2,29,30,31) |
| InChIKey | PEQQUNRJOMENEO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |