C17H17BrFN3O — CID 144543544
3-[4-(1H-benzimidazol-2-ylamino)phenyl]propanoyl fluoride;bromomethane (PubChem CID 144543544) has the molecular formula C17H17BrFN3O and a molecular weight of 378.25 g/mol. Its IUPAC name is 3-[4-(1H-benzimidazol-2-ylamino)phenyl]propanoyl fluoride;bromomethane.
| Compound Name | 3-[4-(1H-benzimidazol-2-ylamino)phenyl]propanoyl fluoride;bromomethane |
|---|---|
| PubChem CID | 144543544 |
| Molecular Formula | C17H17BrFN3O |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 3-[4-(1H-benzimidazol-2-ylamino)phenyl]propanoyl fluoride;bromomethane |
| SMILES | CBr.O=C(F)CCc1ccc(Nc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C16H14FN3O.CH3Br/c17-15(21)10-7-11-5-8-12(9-6-11)18-16-19-13-3-1-2-4-14(13)20-16;1-2/h1-6,8-9H,7,10H2,(H2,18,19,20);1H3 |
| InChIKey | SUFKGLRKYKHFBC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|