C14H11BrN4OS — CID 136779043
3-(4-bromoanilino)-6-(thiophen-2-ylmethyl)-4H-1,2,4-triazin-5-one (PubChem CID 136779043) has the molecular formula C14H11BrN4OS and a molecular weight of 363.24 g/mol. Its IUPAC name is 3-(4-bromoanilino)-6-(thiophen-2-ylmethyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(4-bromoanilino)-6-(thiophen-2-ylmethyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136779043 |
| Molecular Formula | C14H11BrN4OS |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | 3-(4-bromoanilino)-6-(thiophen-2-ylmethyl)-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(Nc2ccc(Br)cc2)nnc1Cc1cccs1 |
| InChI | InChI=1S/C14H11BrN4OS/c15-9-3-5-10(6-4-9)16-14-17-13(20)12(18-19-14)8-11-2-1-7-21-11/h1-7H,8H2,(H2,16,17,19,20) |
| InChIKey | IBOQSARCVPYUEX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |