C15H21N5O2S — CID 136779677
3-(3-morpholin-4-ylpropylamino)-6-(thiophen-2-ylmethyl)-4H-1,2,4-triazin-5-one (PubChem CID 136779677) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is 3-(3-morpholin-4-ylpropylamino)-6-(thiophen-2-ylmethyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(3-morpholin-4-ylpropylamino)-6-(thiophen-2-ylmethyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136779677 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 3-(3-morpholin-4-ylpropylamino)-6-(thiophen-2-ylmethyl)-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(NCCCN2CCOCC2)nnc1Cc1cccs1 |
| InChI | InChI=1S/C15H21N5O2S/c21-14-13(11-12-3-1-10-23-12)18-19-15(17-14)16-4-2-5-20-6-8-22-9-7-20/h1,3,10H,2,4-9,11H2,(H2,16,17,19,21) |
| InChIKey | RADQAIWUUAPTGQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|