C16H20FN5O2 — CID 135634761
6-(4-fluorophenyl)-3-(3-morpholin-4-ylpropylamino)-4H-1,2,4-triazin-5-one (PubChem CID 135634761) has the molecular formula C16H20FN5O2 and a molecular weight of 333.37 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-3-(3-morpholin-4-ylpropylamino)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-(4-fluorophenyl)-3-(3-morpholin-4-ylpropylamino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135634761 |
| Molecular Formula | C16H20FN5O2 |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 6-(4-fluorophenyl)-3-(3-morpholin-4-ylpropylamino)-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(NCCCN2CCOCC2)nnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H20FN5O2/c17-13-4-2-12(3-5-13)14-15(23)19-16(21-20-14)18-6-1-7-22-8-10-24-11-9-22/h2-5H,1,6-11H2,(H2,18,19,21,23) |
| InChIKey | KHWVCKMVEUSJAQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|