C18H20FN5O2 — CID 20922527
3-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-amine (PubChem CID 20922527) has the molecular formula C18H20FN5O2 and a molecular weight of 357.39 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-amine.
| Compound Name | 3-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 20922527 |
| Molecular Formula | C18H20FN5O2 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-amine |
| SMILES | Fc1ccc(-c2noc3ncnc(NCCCN4CCOCC4)c23)cc1 |
| InChI | InChI=1S/C18H20FN5O2/c19-14-4-2-13(3-5-14)16-15-17(21-12-22-18(15)26-23-16)20-6-1-7-24-8-10-25-11-9-24/h2-5,12H,1,6-11H2,(H,20,21,22) |
| InChIKey | DIHHQXPTTDYCFC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 76.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|