C17H18N4O2S — CID 136778645
3-(3-propoxyanilino)-6-(thiophen-2-ylmethyl)-4H-1,2,4-triazin-5-one (PubChem CID 136778645) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 3-(3-propoxyanilino)-6-(thiophen-2-ylmethyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(3-propoxyanilino)-6-(thiophen-2-ylmethyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136778645 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 3-(3-propoxyanilino)-6-(thiophen-2-ylmethyl)-4H-1,2,4-triazin-5-one |
| SMILES | CCCOc1cccc(Nc2nnc(Cc3cccs3)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C17H18N4O2S/c1-2-8-23-13-6-3-5-12(10-13)18-17-19-16(22)15(20-21-17)11-14-7-4-9-24-14/h3-7,9-10H,2,8,11H2,1H3,(H2,18,19,21,22) |
| InChIKey | JXRMJJLFBLRXMX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |