C20H22N4O3 — CID 136778780
6-[(4-methoxyphenyl)methyl]-3-(4-propoxyanilino)-4H-1,2,4-triazin-5-one (PubChem CID 136778780) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 6-[(4-methoxyphenyl)methyl]-3-(4-propoxyanilino)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-[(4-methoxyphenyl)methyl]-3-(4-propoxyanilino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136778780 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 6-[(4-methoxyphenyl)methyl]-3-(4-propoxyanilino)-4H-1,2,4-triazin-5-one |
| SMILES | CCCOc1ccc(Nc2nnc(Cc3ccc(OC)cc3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C20H22N4O3/c1-3-12-27-17-10-6-15(7-11-17)21-20-22-19(25)18(23-24-20)13-14-4-8-16(26-2)9-5-14/h4-11H,3,12-13H2,1-2H3,(H2,21,22,24,25) |
| InChIKey | PZXSNSXGFRWBGO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |