C19H19FN4O3 — CID 136780260
6-[(4-fluorophenyl)methyl]-3-[2-(4-methoxyphenoxy)ethylamino]-4H-1,2,4-triazin-5-one (PubChem CID 136780260) has the molecular formula C19H19FN4O3 and a molecular weight of 370.38 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methyl]-3-[2-(4-methoxyphenoxy)ethylamino]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-[(4-fluorophenyl)methyl]-3-[2-(4-methoxyphenoxy)ethylamino]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136780260 |
| Molecular Formula | C19H19FN4O3 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 6-[(4-fluorophenyl)methyl]-3-[2-(4-methoxyphenoxy)ethylamino]-4H-1,2,4-triazin-5-one |
| SMILES | COc1ccc(OCCNc2nnc(Cc3ccc(F)cc3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C19H19FN4O3/c1-26-15-6-8-16(9-7-15)27-11-10-21-19-22-18(25)17(23-24-19)12-13-2-4-14(20)5-3-13/h2-9H,10-12H2,1H3,(H2,21,22,24,25) |
| InChIKey | BIGYYNDOJFBDLV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|