C18H27N5O2 — CID 136779931
3-[3-(diethylamino)propylamino]-6-[(4-methoxyphenyl)methyl]-4H-1,2,4-triazin-5-one (PubChem CID 136779931) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 3-[3-(diethylamino)propylamino]-6-[(4-methoxyphenyl)methyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[3-(diethylamino)propylamino]-6-[(4-methoxyphenyl)methyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136779931 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 3-[3-(diethylamino)propylamino]-6-[(4-methoxyphenyl)methyl]-4H-1,2,4-triazin-5-one |
| SMILES | CCN(CC)CCCNc1nnc(Cc2ccc(OC)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C18H27N5O2/c1-4-23(5-2)12-6-11-19-18-20-17(24)16(21-22-18)13-14-7-9-15(25-3)10-8-14/h7-10H,4-6,11-13H2,1-3H3,(H2,19,20,22,24) |
| InChIKey | PNIZJVDKRRCPKJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|