C21H23N5O — CID 136683658
6-benzyl-3-[4-(pyrrolidin-1-ylmethyl)anilino]-4H-1,2,4-triazin-5-one (PubChem CID 136683658) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 6-benzyl-3-[4-(pyrrolidin-1-ylmethyl)anilino]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-benzyl-3-[4-(pyrrolidin-1-ylmethyl)anilino]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136683658 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 6-benzyl-3-[4-(pyrrolidin-1-ylmethyl)anilino]-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(Nc2ccc(CN3CCCC3)cc2)nnc1Cc1ccccc1 |
| InChI | InChI=1S/C21H23N5O/c27-20-19(14-16-6-2-1-3-7-16)24-25-21(23-20)22-18-10-8-17(9-11-18)15-26-12-4-5-13-26/h1-3,6-11H,4-5,12-15H2,(H2,22,23,25,27) |
| InChIKey | DRKDACGKJVDLBS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |