C17H16N4OS — CID 136923271
3-[(4-aminophenyl)methylsulfanyl]-6-benzyl-4H-1,2,4-triazin-5-one (PubChem CID 136923271) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is 3-[(4-aminophenyl)methylsulfanyl]-6-benzyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(4-aminophenyl)methylsulfanyl]-6-benzyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136923271 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 3-[(4-aminophenyl)methylsulfanyl]-6-benzyl-4H-1,2,4-triazin-5-one |
| SMILES | Nc1ccc(CSc2nnc(Cc3ccccc3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C17H16N4OS/c18-14-8-6-13(7-9-14)11-23-17-19-16(22)15(20-21-17)10-12-4-2-1-3-5-12/h1-9H,10-11,18H2,(H,19,21,22) |
| InChIKey | MGWKVQYSWCKPHT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|